CAS 25889-36-5
:3-nitro-4-(trifluoromethyl)phenol
Description:
3-Nitro-4-(trifluoromethyl)phenol, with the CAS number 25889-36-5, is an organic compound characterized by the presence of a nitro group and a trifluoromethyl group attached to a phenolic ring. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The nitro group contributes to its reactivity, making it a useful intermediate in organic synthesis. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity. In terms of solubility, it is generally more soluble in organic solvents than in water, which is common for many fluorinated compounds. The presence of both electron-withdrawing groups (the nitro and trifluoromethyl groups) can significantly affect the compound's electronic properties, stability, and reactivity. Safety data should be consulted for handling, as compounds with nitro and trifluoromethyl groups can pose health and environmental risks.
Formula:C7H4F3NO3
InChI:InChI=1/C7H4F3NO3/c8-7(9,10)5-2-1-4(12)3-6(5)11(13)14/h1-3,12H
SMILES:c1cc(c(cc1O)N(=O)=O)C(F)(F)F
Synonyms:- Phenol, 3-Nitro-4-(Trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Nitro-4-(trifluoromethyl)phenol
CAS:Formula:C7H4F3NO3Purity:98%Color and Shape:SolidMolecular weight:207.10683-Nitro-4-(trifluoromethyl)phenol
CAS:3-Nitro-4-(trifluoromethyl)phenolFormula:C7H4F3NO3Purity:97%Color and Shape: yellow crystalline solidMolecular weight:207.11g/mol3-Nitro-4-(trifluoromethyl)phenol
CAS:3-Nitro-4-(trifluoromethyl)phenol is an amino acid that has been found in fossils of the proterozoic era. It is believed to have played a role in evolution and the onset of life because it was resistant to damage by oxygen free radicals. 3-Nitro-4-(trifluoromethyl)phenol has been shown to be damaging to mesenchymal cells, which are cells that form cartilage and bone, leading to cell death. The chemical damages mesenchymal stem cells, which can lead to diseases such as osteoarthritis or rheumatoid arthritis. Researchers believe that this chemical may have played a role in the orogeny, or mountain formation, that occurred during the late Proterozoic Era.Formula:C7H4F3NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:207.11 g/mol3-Nitro-4-(trifluoromethyl)phenol
CAS:Formula:C7H4F3NO3Purity:98%Color and Shape:SolidMolecular weight:207.108



