CAS 2589-12-0
:4,6-dichloro-1H-imidazo[4,5-c]pyridine
Description:
4,6-Dichloro-1H-imidazo[4,5-c]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features two chlorine atoms substituted at the 4 and 6 positions of the imidazo ring, enhancing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of chlorine atoms can influence its electronic properties, making it a candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure allows for potential interactions with biological targets, which may lead to antimicrobial or anticancer activities. Additionally, its stability and reactivity can be affected by environmental factors, making it important to handle it with care in laboratory settings. Overall, 4,6-dichloro-1H-imidazo[4,5-c]pyridine is a significant compound in the field of organic chemistry and drug discovery.
Formula:C6H3Cl2N3
InChI:InChI=1/C6H3Cl2N3/c7-4-1-3-5(6(8)11-4)10-2-9-3/h1-2H,(H,9,10)
SMILES:c1c2c(c(Cl)nc1Cl)[nH]cn2
Synonyms:- 1H-imidazo[4,5-c]pyridine, 4,6-dichloro-
- 4,6-dichloro-3H-imidazo[4,5-c]pyridine
- 3H-Imidazo[4,5-c]pyridine, 4,6-dichloro-
- 4,6-Dichloroimidazo[4,5-C]Pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,6-Dichloro-1H-imidazo[4,5-c]pyridine
CAS:Formula:C6H3Cl2N3Purity:97%Color and Shape:SolidMolecular weight:188.01414,6-Dichloro-1H-imidazo[4,5-c]pyridine
CAS:4,6-Dichloro-1H-imidazo[4,5-c]pyridinePurity:95%Color and Shape:SolidMolecular weight:188.01g/mol2,6-Dichloro-3-deazapurine
CAS:2,6-Dichloro-3-deazapurine is an isomer of the nucleoside guanosine. It has been shown to inhibit the synthesis of viruses in cell cultures and may be useful in the treatment of leukemia. The synthesis of 2,6-dichloro-3-deazapurine can be achieved through a solid-phase synthesis that uses synthons as starting materials. The molecular modelling studies have shown that this molecule has a potential to bind to adenosine receptor subtypes A2a, A2b, and A3.
Formula:C6H3Cl2N3Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:188.02 g/mol4,6-Dichloro-1H-imidazo[4,5-c]pyridine
CAS:Formula:C6H3Cl2N3Purity:95%Color and Shape:SolidMolecular weight:188.014,6-Dichloroimidazo[4,5-c]pyridine
CAS:Controlled ProductApplications 4,6-Dichloroimidazo[4,5-c]pyridine (cas# 2589-12-0) is a compound useful in organic synthesis.
Formula:C6H3Cl2N3Color and Shape:NeatMolecular weight:188.01




