CymitQuimica logo

CAS 2589-20-0

:

N-(4-nitrophenyl)piperidine-1-carboxamide

Description:
N-(4-nitrophenyl)piperidine-1-carboxamide, with the CAS number 2589-20-0, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a carboxamide functional group attached to the piperidine, along with a nitrophenyl substituent at the nitrogen position. The presence of the nitro group (-NO2) on the phenyl ring contributes to its electron-withdrawing properties, which can influence the compound's reactivity and solubility. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The molecular structure suggests potential interactions with biological targets, and its properties can be further explored through various analytical techniques. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, N-(4-nitrophenyl)piperidine-1-carboxamide serves as a valuable compound for research and development in various chemical and pharmaceutical applications.
Formula:C12H15N3O3
InChI:InChI=1/C12H15N3O3/c16-12(14-8-2-1-3-9-14)13-10-4-6-11(7-5-10)15(17)18/h4-7H,1-3,8-9H2,(H,13,16)
Synonyms:
  • 1-piperidinecarboxamide, N-(4-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.