CAS 25900-68-9
:(2E)-{[(dimethylcarbamoyl)oxy]imino}(phenyl)ethanenitrile
Description:
The chemical substance known as (2E)-{[(dimethylcarbamoyl)oxy]imino}(phenyl)ethanenitrile, with the CAS number 25900-68-9, is characterized by its complex structure, which includes a phenyl group, a nitrile functional group, and a dimethylcarbamoyl moiety. This compound features an imino linkage, indicating the presence of a double bond between nitrogen and carbon, which contributes to its reactivity and potential applications in organic synthesis. The dimethylcarbamoyl group suggests that it may exhibit properties typical of carbamates, such as potential biological activity or use as a reagent in chemical reactions. The presence of the nitrile group indicates that it may participate in nucleophilic addition reactions or serve as a precursor for further chemical transformations. Overall, this compound's unique functional groups and structural features make it of interest in various fields, including medicinal chemistry and materials science, where it may be explored for its potential applications.
Formula:C11H11N3O2
InChI:InChI=1/C11H11N3O2/c1-14(2)11(15)16-13-10(8-12)9-6-4-3-5-7-9/h3-7H,1-2H3/b13-10-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
