CAS 25911-65-3

3-Aminopyrazine-2-carbonitrile

Description:

3-Aminopyrazine-2-carbonitrile is an organic compound characterized by its pyrazine ring structure, which features an amino group and a cyano group. The presence of the amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, while the cyano group (-C≡N) enhances its reactivity and polarity. This compound is typically a solid at room temperature and is soluble in polar solvents due to its functional groups. It is often used in medicinal chemistry and material science for its potential applications in drug development and as a building block for synthesizing more complex molecules. The compound's reactivity can be attributed to the electron-withdrawing nature of the cyano group, which can influence its behavior in chemical reactions. Additionally, 3-Aminopyrazine-2-carbonitrile may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₄N₄

InChI: InChI=1/C5H4N4/c6-3-4-5(7)9-2-1-8-4/h1-2H,(H2,7,9)

SMILES: c1c[nH]c(=N)c(C#N)n1

Synonyms:

• 2-Pyrazinecarbonitrile, 3-Amino-
• 3-Aminopyrazine-2-Carbonitrile

2-Pyrazinecarbonitrile, 3-amino-

CAS: 25911-65-3

Formula: C₅H₄N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 120.1121

Ref: IN-DA002QZT

3-Aminopyrazine-2-carbonitrile

CAS: 25911-65-3

3-Aminopyrazine-2-carbonitrile

Purity: 98%

Molecular weight: 120.115g/mol

Ref: 54-OR74713

3-Aminopyrazine-2-carbonitrile

CAS: 25911-65-3

Formula: C₅H₄N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 120.115

Ref: 10-F076968