CAS 259143-52-7: 4-Nitrophenyl 2-(acetylamino)-2-deoxy-4-O-(6-deoxy-α-L-galactopyranosyl)-β-D-glucopyranoside
Description:4-Nitrophenyl 2-(acetylamino)-2-deoxy-4-O-(6-deoxy-α-L-galactopyranosyl)-β-D-glucopyranoside is a complex glycoside that features a phenolic nitro group, an acetylamino group, and a glycosyl moiety. This compound is characterized by its structural components, which include a β-D-glucopyranoside backbone and a 6-deoxy-α-L-galactopyranosyl unit, contributing to its biological activity and solubility properties. The presence of the nitrophenyl group suggests potential applications in biochemical assays or as a chromogenic substrate due to its ability to undergo colorimetric changes. The acetylamino group enhances the compound's stability and solubility in organic solvents. This substance may exhibit specific interactions with enzymes or receptors, making it of interest in medicinal chemistry and glycoscience. Its CAS number, 259143-52-7, allows for precise identification in chemical databases, facilitating research and development in various fields, including pharmacology and biochemistry. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry.
Formula:C20H28N2O12
InChI:InChI=1S/C20H28N2O12/c1-8-14(25)16(27)17(28)20(31-8)34-18-12(7-23)33-19(13(15(18)26)21-9(2)24)32-11-5-3-10(4-6-11)22(29)30/h3-6,8,12-20,23,25-28H,7H2,1-2H3,(H,21,24)/t8-,12+,13+,14+,15+,16+,17-,18+,19+,20-/m0/s1
InChI key:InChIKey=JQGZMRCVWYGGHU-PIRDJKQGSA-N
SMILES:O=C(NC1C(OC2=CC=C(C=C2)N(=O)=O)OC(CO)C(OC3OC(C)C(O)C(O)C3O)C1O)C
- Synonyms:
- 4-Nitrophenyl 2-(acetylamino)-2-deoxy-4-O-(6-deoxy-α-L-galactopyranosyl)-β-D-glucopyranoside
- β-D-Glucopyranoside, 4-nitrophenyl 2-(acetylamino)-2-deoxy-4-O-(6-deoxy-α-L-galactopyranosyl)-

β-D-Glucopyranoside, 4-nitrophenyl 2-(acetylamino)-2-deoxy-4-O-(6-deoxy-α-L-galactopyranosyl)-
Ref: IN-DA002R1D
Undefined size | To inquire |

4-Nitrophenyl 2-Acetamido-2-deoxy-4-O-α-L-fucopyranosyl)-β-D-glucopyranoside
Controlled ProductRef: TR-N499205
1mg | 340.00 € |

4-Nitrophenyl 2-acetamido-2-deoxy-4-O-(a-L-fucopyranosyl)-b-D-glucopyranoside
Ref: 3D-EN06442
1mg | 713.00 € | ||
5mg | 2,636.00 € | ||
10mg | 4,217.00 € |