CAS 259209-20-6: (4-fluoro-2-hydroxyphenyl)boronic acid

Description:(4-Fluoro-2-hydroxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenolic structure. This compound features a fluorine atom at the para position relative to the hydroxyl group on the aromatic ring, which can influence its reactivity and solubility. Typically, boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. The hydroxyl group contributes to its acidity, allowing it to participate in reactions such as Suzuki coupling, which is essential for forming carbon-carbon bonds. Additionally, the presence of the fluorine atom can enhance the compound's electronic properties, potentially affecting its interactions in biological systems. Overall, (4-fluoro-2-hydroxyphenyl)boronic acid is a versatile compound with applications in drug development and materials science, owing to its unique structural features and reactivity.

Formula:C₆H₆BFO₃

InChI:InChI=1/C6H6BFO3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,9-11H

Synonyms:
boronic acid, B-(4-fluoro-2-hydroxyphenyl)-
4-Fluoro-2-hydroxyphenylboronic acid

Found 5 products.

Product data	Purity	Price range	Estimated delivery
5-Fluoro-2-hydroxyphenylboronic Acid (contains varying amounts of Anhydride) REF: 3B-F0977CAS: 259209-20-6	97.0 to 114.0 %	76.00 €~212.00 €	Tue 08 Apr 25
Boronic acid, B-(5-fluoro-2-hydroxyphenyl)- REF: IN-DA002R1UCAS: 259209-20-6	97%	To inquire	Tue 15 Apr 25
5-Fluoro-2-hydroxybenzeneboronic acid REF: 54-PC1627CAS: 259209-20-6	97%	32.00 €~86.00 €	Wed 16 Apr 25
5-Fluoro-2-hydroxyphenylboronic acid REF: 10-F033094CAS: 259209-20-6	97.0%	To inquire	Fri 25 Apr 25
(5-fluoro-2-hydroxyphenyl)boronic Acid REF: 3D-FF104651CAS: 259209-20-6	Min. 95%	- - -	Discontinued product