CAS 25924-78-1
:Piperyline
Description:
Piperyline, with the CAS number 25924-78-1, is a chemical compound classified as a piperidine derivative. It is characterized by a six-membered ring structure containing one nitrogen atom and five carbon atoms. This compound typically exhibits a colorless to pale yellow liquid form and has a distinctive odor. Piperyline is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its chemical properties include moderate solubility in organic solvents and relatively low solubility in water, which is common for many nitrogen-containing heterocycles. The compound may also exhibit basic properties due to the presence of the nitrogen atom, allowing it to participate in various chemical reactions, including alkylation and acylation. Safety data indicates that, like many organic compounds, piperyline should be handled with care, as it may pose health risks upon exposure. Overall, piperyline is a versatile compound with significance in chemical research and industrial applications.
Formula:C16H17NO3
InChI:InChI=1S/C16H17NO3/c18-16(17-9-3-4-10-17)6-2-1-5-13-7-8-14-15(11-13)20-12-19-14/h1-2,5-8,11H,3-4,9-10,12H2/b5-1+,6-2+
InChI key:InChIKey=GQIJYUMTOUBHSH-IJIVKGSJSA-N
SMILES:C(=C/C=C/C(=O)N1CCCC1)\C=2C=C3C(=CC2)OCO3
Synonyms:- Pyrrolidine, 1-[(2E,4E)-5-(1,3-benzodioxol-5-yl)-1-oxo-2,4-pentadienyl]-
- (2E,4E)-5-(1,3-Benzodioxol-5-yl)-1-(1-pyrrolidinyl)-2,4-pentadien-1-one
- Pyrrolidine, 1-piperoyl-, (E,E)-
- 2,4-Pentadien-1-one, 5-(1,3-benzodioxol-5-yl)-1-(1-pyrrolidinyl)-, (2E,4E)-
- Pyrrolidine, 1-[5-(1,3-benzodioxol-5-yl)-1-oxo-2,4-pentadienyl]-, (E,E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Piperyline
CAS:Piperyline is an alkanoic acid that has shown to be effective against skin cancer. It also has antimicrobial properties, which may be due to its ability to bind metal ions and form polymeric compounds. Piperyline inhibits microbial growth by inhibiting the synthesis of proteins and nucleic acids. The antimicrobial activity is related to its cationic polymerization with hydroxyl groups, which forms a structure that can inhibit microbial enzymes and disrupt microbial cell membranes. This compound also interacts with the skin's natural lipids, making it difficult for microorganisms to attach and grow on the skin. Piperyline is synthesized in organic chemistry laboratories as an amide precursor of other pharmaceuticals such as penicillin.
Formula:C16H17NO3Purity:Min. 95%Molecular weight:271.31 g/mol

