CAS 259259-80-8: cobalt(2+) (2E,2'E)-3,3'-{[(1S,2S)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diyl]bis[nitrilo(E)methylylidene]}bis(4-oxopent-2-en-2-olate)
Description:Cobalt(2+) (2E,2'E)-3,3'-{[(1S,2S)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diyl]bis[nitrilo(E)methylylidene]}bis(4-oxopent-2-en-2-olate) is a complex coordination compound featuring cobalt in a +2 oxidation state. This compound is characterized by its intricate organic ligand structure, which includes multiple aromatic groups and functional moieties that enhance its stability and solubility. The presence of the nitrilo and enolate groups suggests potential reactivity and coordination capabilities, making it of interest in various chemical applications, including catalysis and materials science. The compound's stereochemistry, indicated by the (1S,2S) configuration, implies specific spatial arrangements that can influence its chemical behavior and interactions. Additionally, the presence of bulky trimethylphenyl groups may provide steric hindrance, affecting the compound's reactivity and interactions with other molecules. Overall, this cobalt complex exemplifies the diverse chemistry of transition metal coordination compounds, with potential applications in fields such as organic synthesis and catalysis.
Formula:C32H38CoN2O4
InChI:InChI=1/C32H40N2O4.Co/c1-17-11-19(3)29(20(4)12-17)31(33-15-27(23(7)35)24(8)36)32(34-16-28(25(9)37)26(10)38)30-21(5)13-18(2)14-22(30)6;/h11-16,31-32,35,37H,1-10H3;/q;+2/p-2/b27-23+,28-25+,33-15+,34-16+;/t31-,32-;/m0./s1