CAS 259269-84-6

2-Amino-3-bromo-5-fluorobenzoic acid

Description:

2-Amino-3-bromo-5-fluorobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group, a bromine atom, and a fluorine atom. The presence of the amino group (-NH2) indicates that it is an amine, contributing to its basicity and potential for forming hydrogen bonds. The bromine and fluorine substituents introduce halogen functionalities, which can influence the compound's reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group (-COOH). Its unique combination of substituents can affect its biological activity, making it of interest in pharmaceutical research and development. Additionally, the compound's structure suggests potential applications in the synthesis of more complex molecules or as a building block in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.

Formula: C₇H₅BrFNO₂

InChI: InChI=1/C7H5BrFNO2/c8-5-2-3(9)1-4(6(5)10)7(11)12/h1-2H,10H2,(H,11,12)

SMILES: c1c(cc(c(c1C(=O)O)N)Br)F

Synonyms:

• Benzoic acid, 2-amino-3-bromo-5-fluoro-

Benzoic acid, 2-amino-3-bromo-5-fluoro-

CAS: 259269-84-6

Formula: C₇H₅BrFNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 234.0225

Ref: IN-DA002R2Z

2-Amino-3-bromo-5-fluorobenzoic acid

CAS: 259269-84-6

2-Amino-3-bromo-5-fluorobenzoic acid

Purity: ≥95%

Molecular weight: 234.02g/mol

Ref: 54-PC32490

2-Amino-3-bromo-5-fluorobenzoic acid

CAS: 259269-84-6

Formula: C₇H₅BrFNO₂

Purity: 90%

Color and Shape: Solid

Molecular weight: 234.024

Ref: 10-F034810