CAS 259270-28-5

10-(ethoxy-fluoro-phosphoryl)-N-[5-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-6-yl)pentanoylamino]pentyl]decanamide

Description:

The chemical substance known as "10-(ethoxy-fluoro-phosphoryl)-N-[5-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-6-yl)pentanoylamino]pentyl]decanamide," with the CAS number 259270-28-5, is a complex organic compound characterized by its unique structural features. It contains a decanamide backbone, which is a long-chain fatty acid derivative, and incorporates a phosphoryl group that enhances its reactivity and potential biological activity. The presence of an ethoxy group suggests increased solubility in organic solvents, while the fluorine atom may impart specific electronic properties that can influence its interaction with biological targets. Additionally, the thieno[3,4-d]imidazole moiety indicates potential pharmacological relevance, as this structure is often associated with various biological activities. Overall, this compound's intricate structure suggests it may have applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₂₇H₅₀FN₄O₅PS

InChI: InChI=1/C27H50FN4O5PS/c1-2-37-38(28,36)20-14-7-5-3-4-6-9-16-24(33)29-18-12-8-13-19-30-25(34)17-11-10-15-23-26-22(21-39-23)31-27(35)32-26/h22-23,26H,2-21H2,1H3,(H,29,33)(H,30,34)(H2,31,32,35)

SMILES: CCOP(=O)(CCCCCCCCCC(=NCCCCCN=C(CCCCC1C2C(CS1)N=C(N2)O)O)O)F

FP-Biotin

CAS: 259270-28-5

Formula: C₂₇H₅₀FN₄O₅PS

Color and Shape: Solid

Molecular weight: 592.7469

Ref: IN-DA002R3O

FP-Biotin

CAS: 259270-28-5

FP-biotin: organophosphorus toxicant for biomarker discovery, targets FAAH, ABHD6, MAG-lipase in plasma via avidin-bead purification.

Formula: C₂₇H₅₀FN₄O₅PS

Color and Shape: Solid

Molecular weight: 592.75

Ref: TM-T40226

FP-Biotin (Mixture of Diastereomers)

Controlled Product

CAS: 259270-28-5

Formula: C₂₇H₅₀FN₄O₅PS

Color and Shape: Neat

Molecular weight: 592.75

Ref: TR-F755400