CAS 2593-81-9
:2-Methyl-4-nitro-1H-isoindole-1,3(2H)-dione
Description:
2-Methyl-4-nitro-1H-isoindole-1,3(2H)-dione, also known by its CAS number 2593-81-9, is an organic compound characterized by its isoindole structure, which features a fused bicyclic system. This compound contains a methyl group and a nitro group, contributing to its unique chemical properties. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the nitro group introduces significant electron-withdrawing characteristics, influencing its reactivity and potential applications in organic synthesis. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its derivatives can be explored for various applications, including dyes, pharmaceuticals, and agrochemicals. The stability and reactivity of 2-Methyl-4-nitro-1H-isoindole-1,3(2H)-dione can be affected by factors such as pH and the presence of other functional groups in a reaction environment. Overall, this compound serves as a valuable building block in synthetic organic chemistry and materials science.
Formula:C9H6N2O4
InChI:InChI=1S/C9H6N2O4/c1-10-8(12)5-3-2-4-6(11(14)15)7(5)9(10)13/h2-4H,1H3
InChI key:InChIKey=FWIZOFDVGZCRTB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(C(=O)N(C)C2=O)=CC=C1
Synonyms:- 3-Nitro-N-methylphthalimide
- 2-Methyl-4-nitro-1H-isoindole-1,3(2H)-dione
- Phthalimide, N-methyl-3-nitro-
- 1H-isoindole-1,3(2H)-dione, 2-methyl-4-nitro-
- 1H-Isoindole-1,3(2H)-dione, 2-methyl-4-nitro-
- 2-Methyl-4-nitro-1H-isoindole-1,3(2H)-dione
- N-Methyl-3-nitrophthalimide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Methyl-4-nitro-1H-isoindole-1,3(2H)-dione
CAS:Formula:C9H6N2O4Color and Shape:SolidMolecular weight:206.1549
