CymitQuimica logo

CAS 25939-05-3

:

N-(2,4,6-Trichlorophenyl)benzenecarbohydrazonoyl chloride

Description:
N-(2,4,6-Trichlorophenyl)benzenecarbohydrazonoyl chloride is a chemical compound characterized by its complex structure, which includes a hydrazone functional group and a chlorinated aromatic system. This compound typically appears as a solid and is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic substitution reactions. The presence of multiple chlorine atoms on the phenyl ring enhances its electrophilic character, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. Additionally, the compound may exhibit biological activity, although specific pharmacological properties would depend on further studies. Safety precautions are essential when handling this substance, as it may pose hazards such as toxicity or irritancy. Proper storage conditions and protective equipment are recommended to mitigate risks associated with exposure. Overall, N-(2,4,6-Trichlorophenyl)benzenecarbohydrazonoyl chloride serves as a valuable intermediate in chemical synthesis and research.
Formula:C13H8Cl4N2
InChI:InChI=1S/C13H8Cl4N2/c14-9-6-10(15)12(11(16)7-9)18-19-13(17)8-4-2-1-3-5-8/h1-7,18H
InChI key:InChIKey=QVMATSPQIBFRPZ-UHFFFAOYSA-N
SMILES:N(N=C(Cl)C1=CC=CC=C1)C2=C(Cl)C=C(Cl)C=C2Cl
Synonyms:
  • Benzenecarbohydrazonoyl chloride, N-(2,4,6-trichlorophenyl)-
  • N-(2,4,6-Trichlorophenyl)benzenecarbohydrazonoyl chloride
  • Benzoyl chloride, (2,4,6-trichlorophenyl)hydrazone
  • Benzoyl chloride, 2,4,6-trichlorophenylhydrazones
  • U 27415
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.