CAS 25939-87-1

pyrazolo[1,5-a]pyrimidine-3-carbonitrile

Description:

Pyrazolo[1,5-a]pyrimidine-3-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyrimidine rings. This compound features a carbonitrile functional group at the 3-position of the pyrimidine ring, contributing to its reactivity and potential applications in medicinal chemistry. Pyrazolo[1,5-a]pyrimidines are known for their biological activity, often exhibiting properties such as anti-inflammatory, anti-cancer, and anti-viral effects, making them of interest in drug development. The presence of the carbonitrile group enhances the compound's ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. Its molecular structure allows for potential interactions with biological targets, which is a key consideration in pharmacological studies. Overall, pyrazolo[1,5-a]pyrimidine-3-carbonitrile represents a significant class of compounds with diverse applications in chemistry and pharmaceuticals.

Formula: C₇H₄N₄

InChI: InChI=1/C7H4N4/c8-4-6-5-10-11-3-1-2-9-7(6)11/h1-3,5H

SMILES: c1cnc2c(C#N)cnn2c1

pyrazolo[1,5-a]pyrimidine-3-carbonitrile

CAS: 25939-87-1

Formula: C₇H₄N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 144.1335

Ref: IN-DA002R49

3-Cyanopyrazolo[1,5-a]Pyrimidine

CAS: 25939-87-1

3-Cyanopyrazolo[1,5-a]Pyrimidine

Purity: 98%

Molecular weight: 144.13g/mol

Ref: 54-OR1010967

Pyrazolo[1,5-a]pyrimidine-3-carbonitrile

CAS: 25939-87-1

Formula: C₇H₄N₄

Purity: 98%+(GC-MS);RG

Color and Shape: Solid, Red or  white powder

Molecular weight: 144.137

Ref: 10-F025497