CAS 25940-35-6

Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

Description:

Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group at the 3-position of the pyrimidine ring, enhancing its reactivity and solubility in polar solvents. It typically exhibits moderate to high stability under standard conditions, although it may be sensitive to strong acids or bases. The presence of the carboxylic acid group allows for potential interactions such as hydrogen bonding, making it useful in various chemical reactions, including esterification and amidation. Pyrazolo[1,5-a]pyrimidine derivatives are of interest in medicinal chemistry due to their biological activities, including potential anti-inflammatory and anti-cancer properties. The compound's molecular structure and functional groups can influence its pharmacokinetics and pharmacodynamics, making it a subject of research in drug development. Overall, Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a versatile compound with applications in both synthetic chemistry and pharmaceutical research.

Formula: C₇H₅N₃O₂

InChI: InChI=1/C7H5N3O2/c11-7(12)5-4-9-10-3-1-2-8-6(5)10/h1-4H,(H,11,12)

SMILES: c1cnc2c(cnn2c1)C(=O)O

Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

CAS: 25940-35-6

Formula: C₇H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1335

Ref: IN-DA002R5L

Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

CAS: 25940-35-6

Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

Purity: 98%

Molecular weight: 163.13g/mol

Ref: 54-OR41128

Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

CAS: 25940-35-6

Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a pyrimidine analog and an electron transfer agent. It is a potent inhibitor of the enzyme dehydrogenase, which catalyzes the conversion of nicotinamide adenine dinucleotide (NAD) to nicotinamide adenine dinucleotide phosphate (NADP). Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid has been shown to have anti-inflammatory properties and also inhibits the production of b-raf protein. This drug has also been shown to be a potent inhibitor of mitochondrial electron transport in cancer cells. Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid binds to the metal centers in mitochondria, thereby inhibiting oxidative phosphorylation and reducing ATP synthesis. This ultimately leads to cell death by apoptosis.

Formula: C₇H₅N₃O₂

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 163.13 g/mol

Ref: 3D-FP16388

Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

CAS: 25940-35-6

Formula: C₇H₅N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.136

Ref: 10-F028202