CAS 25941-03-1: [(3R,5R,6S)-3,4,5,6-tetraacetoxytetrahydropyran-2-yl]methyl acetate
Description:The chemical substance known as [(3R,5R,6S)-3,4,5,6-tetraacetoxytetrahydropyran-2-yl]methyl acetate, with the CAS number 25941-03-1, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple acetoxy groups, indicating that it has four acetyl functional groups attached to the tetrahydropyran framework, contributing to its reactivity and solubility in organic solvents. The stereochemistry of the molecule, denoted by the (3R,5R,6S) configuration, suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential use as intermediates in the synthesis of pharmaceuticals or as glycosyl donors in carbohydrate chemistry. The presence of the methyl acetate moiety further indicates potential for esterification reactions. Overall, this compound's structural features and functional groups make it a subject of interest in organic synthesis and chemical research.
Formula:C16H22O11
InChI:InChI=1/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12?,13-,14?,15-,16-/m1/s1