CAS 2595-90-6

3-(Bromomethyl)pyrene

Description:

3-(Bromomethyl)pyrene is an organic compound that belongs to the polycyclic aromatic hydrocarbon family, characterized by its pyrene backbone with a bromomethyl group at the 3-position. This compound typically appears as a solid at room temperature and is known for its fluorescence properties, making it of interest in various applications, including organic electronics and as a fluorescent probe in biochemical studies. The presence of the bromomethyl group introduces reactivity, allowing for further chemical modifications, such as nucleophilic substitutions. Its molecular structure contributes to its hydrophobic nature, which can influence its solubility in organic solvents. Additionally, 3-(Bromomethyl)pyrene may exhibit biological activity, prompting research into its potential effects on living organisms. Safety considerations are essential when handling this compound, as brominated compounds can pose environmental and health risks. Overall, 3-(Bromomethyl)pyrene serves as a valuable compound in both synthetic chemistry and materials science.

Formula: C₁₇H₁₁Br

InChI: InChI=1/C17H11Br/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9H,10H2

SMILES: c1cc2ccc3ccc(CBr)c4ccc(c1)c2c34

Synonyms:

• 1-(Bromomethyl)Pyrene

Pyrene, 1-(bromomethyl)-

CAS: 2595-90-6

Formula: C₁₇H₁₁Br

Purity: 95%

Color and Shape: Solid

Molecular weight: 295.1732

Ref: IN-DA002R65

1-(Bromomethyl)pyrene

CAS: 2595-90-6

1-(Bromomethyl)pyrene

Color and Shape: Green Solid

Molecular weight: 295.17g/mol

Ref: 54-OR8551T

1-(Bromomethyl)pyrene

Controlled Product

CAS: 2595-90-6

Applications 1-(Bromomethyl)pyrene (cas# 2595-90-6) is a compound useful in organic synthesis.

Formula: C₁₇H₁₁Br

Color and Shape: Neat

Molecular weight: 295.17

Ref: TR-B685500

1-(Bromomethyl)pyrene

CAS: 2595-90-6

1-(Bromomethyl)pyrene (1-BP) is a quaternary ammonium salt that is formed by the covalent attachment of bromine to the pyrene molecule. 1-BP is a fluorophore, which means it emits light when excited with an energy source, such as ultraviolet (UV) or visible light. In addition, 1-BP has excellent chemical stability and can be used as a single-stranded DNA probe in nanotubes. The nitrogen atoms on the pyrene ring provide 1-BP with strong hydrogen bonding properties, making it an efficient method for labeling proteins and other molecules.

Formula: C₁₇H₁₁Br

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 295.17 g/mol

Ref: 3D-FB19263

1-(Bromomethyl)pyrene

CAS: 2595-90-6

Formula: C₁₇H₁₁Br

Purity: 90%

Color and Shape: Liquid, No data available.

Molecular weight: 295.179

Ref: 10-F546260