CAS 2595-98-4: D(+)-Talose
Description:D(+)-Talose is a naturally occurring aldohexose sugar, classified as a monosaccharide. It is an epimer of D-galactose, differing in the configuration around one specific carbon atom. D(+)-Talose is characterized by its sweet taste and is typically found in trace amounts in certain plants and microorganisms. The molecular formula of D(+)-Talose is C6H12O6, and it exists in a cyclic form, predominantly as a pyranose. This sugar is known for its role in various biochemical processes and can participate in glycosylation reactions. D(+)-Talose is also of interest in research due to its potential applications in the food industry and pharmaceuticals, particularly in the development of sweeteners and as a building block for more complex carbohydrates. Its CAS number, 2595-98-4, is a unique identifier that facilitates the search for information regarding its properties, safety, and handling. Overall, D(+)-Talose is a significant compound in carbohydrate chemistry, contributing to the understanding of sugar metabolism and its applications in various fields.
Formula:C6H12O6
InChI:InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5-,6+/m1/s1
InChI key:InChIKey=GZCGUPFRVQAUEE-KAZBKCHUSA-N
SMILES:O=CC(O)C(O)C(O)C(O)CO
- Synonyms:
- <span class="text-smallcaps">D</span>(+)-Talose
- D-talopyranose
- Hexose
- NSC 224293
- Talose, <span class="text-smallcaps">D</span>-
- D-Talose
- D(+)-Talose
- Talose, D-
