CAS 25951-90-0
:Benzene, 1,4-dimethyl-, homopolymer
Description:
Benzene, 1,4-dimethyl-, homopolymer, commonly known as poly(1,4-dimethylbenzene) or poly(p-xylene), is a synthetic polymer derived from the polymerization of p-xylene monomers. This polymer exhibits characteristics typical of aromatic compounds, including high thermal stability and resistance to chemical degradation. It is generally insoluble in water but can dissolve in organic solvents such as toluene and xylene. The structure of the polymer features repeating units of the dimethyl-substituted benzene, which contributes to its rigidity and strength. Poly(p-xylene) is known for its excellent electrical insulating properties and is often utilized in applications requiring durability and thermal resistance, such as in coatings, films, and various industrial materials. Additionally, it can be processed through conventional methods like extrusion and injection molding. However, safety considerations must be taken into account, as the monomer and polymer can pose health risks if not handled properly. Overall, benzene, 1,4-dimethyl-, homopolymer is a versatile material with significant industrial applications.
Formula:(C8H10)x
InChI:InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
InChI key:InChIKey=URLKBWYHVLBVBO-UHFFFAOYSA-N
SMILES:CC1=CC=C(C)C=C1
Synonyms:- p-Xylene, polymers
- Poly(p-xylene)
- p-Xylene homopolymer
- p-Xylene polymer
- Benzene, 1,4-dimethyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
