CAS 25953-14-4

1-(2,5-dideoxy-5-iodopentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione

Description:

1-(2,5-Dideoxy-5-iodopentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione, with the CAS number 25953-14-4, is a chemical compound that features a pyrimidine ring substituted with a methyl group and a furanosyl moiety. This compound is characterized by its unique structural components, including a deoxygenated sugar derivative and an iodine atom, which can influence its biological activity and solubility. The presence of the pyrimidine ring suggests potential applications in medicinal chemistry, particularly in the development of nucleoside analogs or antiviral agents. The iodine substitution may enhance the compound's reactivity or alter its pharmacokinetic properties. Additionally, the dione functional groups contribute to its potential as a chelating agent or in forming coordination complexes. Overall, this compound's structural features may provide insights into its reactivity, biological interactions, and potential therapeutic applications, making it a subject of interest in both organic and medicinal chemistry research.

Formula: C₁₀H₁₃IN₂O₄

InChI: InChI=1/C10H13IN2O4/c1-5-4-13(10(16)12-9(5)15)8-2-6(14)7(3-11)17-8/h4,6-8,14H,2-3H2,1H3,(H,12,15,16)

SMILES: Cc1cn(C2CC(C(CI)O2)O)c(=O)nc1O

5’-Deoxy-5’-iodothymidine

CAS: 25953-14-4

Formula: C₁₀H₁₃IN₂O₄

Purity: 95%

Molecular weight: 352.1257

Ref: IN-DA002R6P

5'-Deoxy-5'-iodothymidine

CAS: 25953-14-4

5'-Deoxy-5'-iodothymidine

Purity: ≥ 95%

Molecular weight: 767.53g/mol

Ref: 54-OR1075921

5''-Deoxy-5''-iodothymidine

CAS: 25953-14-4

Ref: 7W-GN5057

5'-Deoxy-5'-iodothymidine

CAS: 25953-14-4

5'-Deoxy-5'-iodothymidine is a Nucleoside Derivative - 5'-Modified nucleoside, Halo-nucleoside.

Formula: C₁₀H₁₃IN₂O₄

Color and Shape: Solid

Molecular weight: 352.13

Ref: TM-TNU1147

5'-Deoxy-5'-iodothymidine

CAS: 25953-14-4

5'-Deoxy-5'-iodothymidine is an antiviral nucleoside that inhibits viral replication by competing with the natural substrate, deoxyribonucleotide triphosphate, for incorporation in DNA. 5'-Deoxy-5'-iodothymidine has been shown to be a novel antiviral agent and an activator of host immune responses against virus infections. 5'-Deoxy-5'-iodothymidine is also used as an intermediate for the synthesis of phosphoramidites, which are used in the production of DNA.

Formula: C₁₀H₁₃IN₂O₄

Purity: Min. 95%

Molecular weight: 352.13 g/mol

Ref: 3D-ND06454