CymitQuimica logo

CAS 259727-10-1

:

1,1-dioctyl-3-(3-triethoxysilylpropyl)urea

Description:
1,1-Dioctyl-3-(3-triethoxysilylpropyl)urea, with the CAS number 259727-10-1, is an organosilicon compound that features both urea and silane functionalities. This compound typically exhibits characteristics such as hydrophobicity due to the long octyl chains, which enhance its compatibility with organic materials. The triethoxysilyl group allows for potential bonding to silica surfaces or other inorganic substrates, making it useful in applications such as surface modification, adhesion promotion, and as a coupling agent in composite materials. The presence of the urea moiety can contribute to its thermal stability and may influence its solubility in various solvents. Additionally, this compound may exhibit low volatility and good thermal stability, making it suitable for use in coatings and sealants. Its unique structure allows for versatility in applications ranging from materials science to nanotechnology, where it can enhance the properties of polymers and improve the performance of composite materials.
Formula:C26H56N2O4Si
InChI:InChI=1/C26H56N2O4Si/c1-6-11-13-15-17-19-23-28(24-20-18-16-14-12-7-2)26(29)27-22-21-25-33(30-8-3,31-9-4)32-10-5/h6-25H2,1-5H3,(H,27,29)
SMILES:CCCCCCCCN(CCCCCCCC)C(=NCCC[Si](OCC)(OCC)OCC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.