CAS 259810-12-3

6,7-Dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-amine

Description:

6,7-Dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-amine is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a pyran and a thiazole ring. This compound features a dihydro-pyran moiety fused to a thiazole, which contributes to its potential biological activity. The presence of an amine group enhances its reactivity and solubility in polar solvents. Typically, compounds of this nature may exhibit a range of pharmacological properties, making them of interest in medicinal chemistry. The thiazole ring is known for its role in various biological activities, including antimicrobial and anticancer properties. Additionally, the structural features of this compound may allow for interactions with biological targets, potentially leading to therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its reactivity and interactions in various chemical environments. As with many heterocycles, the specific properties and applications can vary widely based on the substituents and functional groups present in the molecule.

Formula: C₆H₈N₂OS

InChI: InChI=1/C6H8N2OS/c7-6-8-4-1-2-9-3-5(4)10-6/h1-3H2,(H2,7,8)

SMILES: C1COCc2c1[nH]c(=N)s2

Synonyms:

• 4H-Pyrano[4,3-d]thiazol-2-amine, 6,7-dihydro-
• 6,7-Dihydro-4H-Pyrano[4,3-D]Thiazol-2-Ylamine

4H-​Pyrano[4,​3-​d]​thiazol-​2-​amine, 6,​7-​dihydro-

CAS: 259810-12-3

Formula: C₆H₈N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.2055

Ref: IN-DA002RAF

6,7-Dihydro-4H-pyrano[4,3-d]thiazol-2-amine

CAS: 259810-12-3

6,7-Dihydro-4H-pyrano[4,3-d]thiazol-2-amine

Purity: 98%

Color and Shape: Brown Solid

Molecular weight: 156.21g/mol

Ref: 54-OR110862

6,7-Dihydro-4H-pyrano[4,3-d]thiazol-2-amine

CAS: 259810-12-3

Formula: C₆H₈N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.2

Ref: 10-F076032