CAS 259827-73-1
:Phosphonic acid, hexyl-, 4-nitrophenyl octyl ester
Description:
Phosphonic acid, hexyl-, 4-nitrophenyl octyl ester is an organophosphorus compound characterized by its phosphonic acid functional group, which is known for its strong affinity for metal ions and potential applications in agriculture and materials science. This compound features a hexyl group and an octyl ester moiety, contributing to its hydrophobic properties, which can influence its solubility and interaction with biological systems. The presence of the 4-nitrophenyl group introduces a nitro substituent, which can enhance the compound's reactivity and may impart specific electronic properties. Typically, such compounds are studied for their potential use in various applications, including as herbicides, surfactants, or in the synthesis of more complex molecules. The structural characteristics, including the length of the alkyl chains and the presence of functional groups, play a crucial role in determining the compound's physical and chemical properties, such as boiling point, melting point, and reactivity. Safety and handling considerations are essential due to the potential toxicity associated with organophosphorus compounds.
Formula:C20H34NO5P
InChI:InChI=1S/C20H34NO5P/c1-3-5-7-9-10-11-17-25-27(24,18-12-8-6-4-2)26-20-15-13-19(14-16-20)21(22)23/h13-16H,3-12,17-18H2,1-2H3
InChI key:InChIKey=ASHRBQSEDCWUGD-UHFFFAOYSA-N
SMILES:O(P(OCCCCCCCC)(CCCCCC)=O)C1=CC=C(N(=O)=O)C=C1
Synonyms:- Phosphonic acid, hexyl-, 4-nitrophenyl octyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Lipase Suicide Inhibitor C03
CAS:Lipase suicide inhibitor product with the ability to determine lipase and hydrolase activity in complex protein mixtures. They are suitable for use in active site titration experiments to establish the molar amount of enzyme.
Octyl 4-nitrophenyl hexyl phosphonate
CAS:Octyl 4-nitrophenyl hexyl phosphonate is a lipase suicide inhibitor that is a chromogenic substrate for lipases which upon enzymatic action, binds irreversibly to the lipase and inactivates it. The substrate can be used for the determination of active sites in lipases, especially in lipases preferring hydrophobic leaving groups.Purity:Min. 95%Molecular weight:399.46
