CAS 25983-14-6

2,3,6,7-tetrachloroquinoxaline

Description:

2,3,6,7-tetrachloroquinoxaline is a synthetic organic compound characterized by its chlorinated quinoxaline structure. It features four chlorine atoms substituted at the 2, 3, 6, and 7 positions of the quinoxaline ring, which is a bicyclic compound composed of fused benzene and pyrazine rings. This compound is typically a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. Its chlorinated nature may impart unique chemical properties, such as increased stability and altered reactivity compared to non-chlorinated analogs. Additionally, 2,3,6,7-tetrachloroquinoxaline may exhibit biological activity, making it of interest in medicinal chemistry. However, due to the presence of chlorine, it is essential to handle this compound with care, as chlorinated compounds can pose environmental and health risks. Proper safety measures should be observed when working with this substance in laboratory settings.

Formula: C₈H₂Cl₄N₂

InChI: InChI=1/C8H2Cl4N2/c9-3-1-5-6(2-4(3)10)14-8(12)7(11)13-5/h1-2H

SMILES: c1c(c(cc2c1nc(c(Cl)n2)Cl)Cl)Cl

2,3,6,7-Tetrachloroquinoxaline

CAS: 25983-14-6

Formula: C₈H₂Cl₄N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 267.9269

Ref: IN-DA0037HC

2,3,6,7-Tetrachloroquinoxaline

CAS: 25983-14-6

2,3,6,7-Tetrachloroquinoxaline

Formula: C₈H₂Cl₄N₂

Purity: 97%

Color and Shape: yellow solid

Molecular weight: 267.92688g/mol

Ref: 54-OR11240

2,3,6,7-Tetrachloroquinoxaline

CAS: 25983-14-6

Formula: C₈H₂Cl₄N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 267.92

Ref: 10-F240489