CAS 259860-08-7

6-Bromo-5-fluoro-1H-indole

Description:

6-Bromo-5-fluoro-1H-indole is a heterocyclic organic compound that belongs to the indole family, characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This compound features a bromine atom at the 6-position and a fluorine atom at the 5-position of the indole ring, which contributes to its unique chemical properties and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogen substituents can influence its electronic properties, making it a potential candidate for various applications in medicinal chemistry and material science. Additionally, 6-Bromo-5-fluoro-1H-indole may serve as an important intermediate in the synthesis of pharmaceuticals, agrochemicals, and other functional materials. Its reactivity can be attributed to the electron-withdrawing nature of the bromine and fluorine atoms, which can affect nucleophilic and electrophilic reactions. As with many indole derivatives, it may also exhibit biological activity, warranting further investigation in drug discovery and development.

Formula: C₈H₅BrFN

InChI: InChI=1/C8H5BrFN/c9-6-4-8-5(1-2-11-8)3-7(6)10/h1-4,11H

SMILES: c1c[nH]c2cc(c(cc12)F)Br

Synonyms:

• 1H-indole, 6-bromo-5-fluoro-
• 6-Bromo-5-Fluoroindole

6-bromo-5-fluoro-1H-indole

CAS: 259860-08-7

Formula: C₈H₅BrFN

Purity: 96%

Color and Shape: Solid

Molecular weight: 214.0344

Ref: IN-DA00366K

6-Bromo-5-fluoro-1H-indole

CAS: 259860-08-7

6-Bromo-5-fluoro-1H-indole

Purity: 97%

Molecular weight: 214.03g/mol

Ref: 54-PC100091

6-Bromo-5-fluoro-1H-indole

CAS: 259860-08-7

Formula: C₈H₅BrFN

Purity: 96%

Color and Shape: Brown powder

Molecular weight: 214.037

Ref: 10-F092058