CAS 25989-14-4
:Benzene, 1,1′-(1,2-ethynediyl)bis-, homopolymer
Description:
Benzene, 1,1′-(1,2-ethynediyl)bis-, homopolymer, commonly known as poly(phenylene ethynylene), is a synthetic polymer characterized by its unique structure that includes alternating benzene rings and ethynylene linkages. This polymer exhibits notable thermal stability and mechanical strength, making it suitable for various applications in materials science and nanotechnology. Its conjugated structure allows for effective electron delocalization, contributing to its optical properties, including fluorescence and potential use in organic light-emitting diodes (OLEDs) and photovoltaic devices. The polymer is typically insoluble in common solvents due to its rigid structure, which can limit its processability but enhances its stability. Additionally, poly(phenylene ethynylene) can be functionalized to introduce specific properties or enhance compatibility with other materials. Safety data indicates that, like many polymers, it should be handled with care to avoid inhalation or skin contact, and proper disposal methods should be followed to minimize environmental impact. Overall, this polymer represents a significant area of research in advanced materials due to its unique properties and potential applications.
Formula:(C14H10)x
InChI:InChI=1S/C14H10/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-10H
InChI key:InChIKey=JRXXLCKWQFKACW-UHFFFAOYSA-N
SMILES:C(#CC1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Benzene, 1,1′-(1,2-ethynediyl)bis-, homopolymer
- Polytolan
- Poly(diphenylacetylene)
- Acetylene, diphenyl-, polymers
- Diphenylacetylene polymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
