CAS 25990-59-4
:xylo-Hexos-2-ulose
Description:
Xylo-Hexos-2-ulose, with the CAS number 25990-59-4, is a sugar derivative that belongs to the class of hexoses, specifically a ketose. It is characterized by its six-carbon backbone and the presence of a ketone functional group, which distinguishes it from aldoses. This compound is typically involved in various biochemical pathways, including those related to carbohydrate metabolism. Its structure allows it to participate in reactions such as isomerization and phosphorylation, making it relevant in metabolic processes. Xylo-Hexos-2-ulose may also exhibit specific stereochemistry, influencing its reactivity and interactions with enzymes. As a sugar, it is likely soluble in water and may play a role in cellular energy production or serve as a precursor for other biomolecules. Understanding its properties and behavior is essential for applications in biochemistry and related fields, particularly in the study of metabolic pathways and the synthesis of complex carbohydrates.
Formula:C6H10O6
InChI:InChI=1/C6H10O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,4-6,8,10-12H,2H2/t4-,5+,6+/s2
InChI key:InChIKey=DCNMIDLYWOTSGK-DWFKHXNSNA-N
SMILES:[C@@H]([C@H](C(C=O)=O)O)([C@@H](CO)O)O
Synonyms:- Sorboson
- xylo-Hexos-2-ulose
- Idosone
- Sorbosone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
