CAS 25991-27-9
:3-Carbomethoxy-2-pyrone
Description:
3-Carbomethoxy-2-pyrone, with the CAS number 25991-27-9, is an organic compound belonging to the class of pyrone derivatives. It features a pyrone ring, which is a six-membered lactone containing a carbonyl group and an ether functionality. This compound is characterized by the presence of a methoxycarbonyl group (-COOCH3) at the 3-position of the pyrone ring, contributing to its reactivity and potential applications in organic synthesis. 3-Carbomethoxy-2-pyrone is typically a yellow to brown solid, exhibiting solubility in organic solvents such as ethanol and dichloromethane. It is known for its potential biological activities, including antimicrobial and antioxidant properties, making it of interest in pharmaceutical research. Additionally, its structure allows for various chemical modifications, which can lead to the development of new derivatives with enhanced properties. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with exposure.
Formula:C7H6O4
InChI:InChI=1S/C7H6O4/c1-10-6(8)5-3-2-4-11-7(5)9/h2-4H,1H3
InChI key:InChIKey=GJVZWOMUTYNUCE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(=O)OC=CC1
Synonyms:- 3-Carbomethoxy-2-pyrone
- Methyl 2-oxo-2H-pyran-3-carboxylate
- Methyl 2-pyrone-3-carboxylate
- 2H-Pyran-3-carboxylic acid, 2-oxo-, methyl ester
- 3-(Methoxycarbonyl)-2-pyrone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-oxo-2H-pyran-3-carboxylate, 98%
CAS:<p>Methyl 2-oxo-2H-pyran-3-carboxylate is used as a reagent to investigate alfa, beta-unsaturated carbonyl compounds for their cytotoxic profiles against oral human normal and tumor cells. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some docu</p>Formula:C7H6O4Purity:98%Color and Shape:Yellow to orange to brown, Crystals or powder or crystalline powderMolecular weight:154.122H-Pyran-3-carboxylic acid, 2-oxo-, methyl ester
CAS:Formula:C7H6O4Purity:95%Color and Shape:SolidMolecular weight:154.1201Ref: IN-DA002RB5
1g43.00€5g115.00€10g181.00€25g285.00€50g606.00€100gTo inquire250gTo inquire250mg26.00€Methyl 2-oxo-2H-pyran-3-carboxylate
CAS:Methyl 2-oxo-2H-pyran-3-carboxylateFormula:C7H6O4Purity:96%Color and Shape: orange to yellow solidMolecular weight:154.12g/molMethyl 2-Oxo-2H-pyran-3-carboxylate
CAS:Formula:C7H6O4Purity:97%Color and Shape:SolidMolecular weight:154.121



