CAS 25999-04-6
:morpholine-4-sulfonamide
Description:
Morpholine-4-sulfonamide is a chemical compound characterized by its sulfonamide functional group attached to a morpholine ring. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, which enhances its utility in different applications. Morpholine-4-sulfonamide is known for its role in medicinal chemistry, particularly as a building block in the synthesis of pharmaceuticals and agrochemicals. Its sulfonamide group contributes to its biological activity, often exhibiting antibacterial properties. The presence of the morpholine ring provides structural stability and can influence the compound's interaction with biological targets. Additionally, morpholine-4-sulfonamide may participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, morpholine-4-sulfonamide is a significant compound in both research and industrial applications due to its unique chemical properties and biological relevance.
Formula:C4H10N2O3S
InChI:InChI=1/C4H10N2O3S/c5-10(7,8)6-1-3-9-4-2-6/h1-4H2,(H2,5,7,8)
SMILES:C1COCCN1S(=O)(=O)N
Synonyms:- 4-Morpholinesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Morpholinesulfonamide
CAS:Formula:C4H10N2O3SPurity:95%Color and Shape:SolidMolecular weight:166.1988morpholine-4-sulfonamide
CAS:Morpholine-4-sulfonamide is a chemical compound that belongs to the class of amides. It is used as a tool in pain models and has been shown to be toxic in animal studies. Morpholine-4-sulfonamide has been shown to inhibit cancer cell growth, apoptosis, and bowel disease in mice. This drug also has anti-inflammatory properties. Morpholine-4-sulfonamide may have some therapeutic potential for the treatment of Alzheimer's disease based on its ability to inhibit nitric oxide release and lysine residues.Formula:C4H10N2O3SPurity:Min. 95%Molecular weight:166.2 g/mol



