CAS 2600-77-3

2-[(3,5-dichlorobiphenyl-2-yl)oxy]-N,N-diethylethanamine

Description:

2-[(3,5-Dichlorobiphenyl-2-yl)oxy]-N,N-diethylethanamine, with CAS number 2600-77-3, is an organic compound characterized by its complex structure, which includes a biphenyl moiety substituted with chlorine atoms and an ether linkage. This compound features a diethylamino group, contributing to its potential as a tertiary amine. The presence of chlorine substituents on the biphenyl ring can influence its chemical reactivity and biological activity, often enhancing lipophilicity and altering interaction with biological targets. The ether functionality may also impart specific solubility characteristics, making it relevant in various chemical applications. This compound is typically studied in the context of its potential use in pharmaceuticals, agrochemicals, or as a research chemical, particularly in studies related to environmental chemistry due to the persistence of chlorinated biphenyls. Safety and handling considerations are essential, as compounds with chlorinated aromatic structures can exhibit toxicity and environmental persistence.

Formula: C₁₈H₂₁Cl₂NO

InChI: InChI=1/C18H21Cl2NO/c1-3-21(4-2)10-11-22-18-16(12-15(19)13-17(18)20)14-8-6-5-7-9-14/h5-9,12-13H,3-4,10-11H2,1-2H3

Synonyms:

• N,N-Diethyl-2-(2,4-dichloro-6-phenylphenoxy)ethylamine
• Ethanamine, 2-((3,5-dichloro(1,1'-biphenyl)-2-yl)oxy)-N,N-diethyl-

Ethanamine, 2-[(3,5-dichloro[1,1'-biphenyl]-2-yl)oxy]-N,N-diethyl-

CAS: 2600-77-3

Formula: C₁₈H₂₁Cl₂NO

Molecular weight: 338.2714

Ref: IN-DA002RDH

Lilly 18947

CAS: 2600-77-3

Lilly 18947 is a cytochrome P450 inhibitor.

Formula: C₁₈H₂₁Cl₂NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 338.27

Ref: TM-T25725