CAS 26000-17-9
:(6beta,14alpha,16beta,17xi)-20-ethyl-4-(hydroxymethyl)-1,6,14,16-tetramethoxyaconitane-7,8-diol
Description:
The chemical substance with the name "(6beta,14alpha,16beta,17xi)-20-ethyl-4-(hydroxymethyl)-1,6,14,16-tetramethoxyaconitane-7,8-diol" and CAS number 26000-17-9 is a complex alkaloid derived from the Aconitum species, commonly known as monkshood or wolfsbane. This compound features a multi-ring structure characteristic of many alkaloids, with multiple methoxy groups and a hydroxymethyl substituent that contribute to its chemical reactivity and potential biological activity. The presence of multiple stereocenters indicates that this compound can exist in various stereoisomeric forms, which may influence its pharmacological properties. Alkaloids like this one are often studied for their potential medicinal applications, including analgesic and anti-inflammatory effects, but they can also exhibit toxicity. As with many natural products, the specific characteristics, such as solubility, melting point, and spectral properties, would depend on the compound's purity and the conditions under which it is analyzed. Further research is necessary to fully elucidate its biological activities and potential therapeutic uses.
Formula:C25H41NO7
InChI:InChI=1/C25H41NO7/c1-6-26-11-22(12-27)8-7-16(31-3)24-14-9-13-15(30-2)10-23(28,17(14)18(13)32-4)25(29,21(24)26)20(33-5)19(22)24/h13-21,27-29H,6-12H2,1-5H3/t13-,14-,15+,16+,17-,18+,19-,20+,21?,22+,23-,24+,25-/m1/s1
InChI key:InChIKey=YOTUXHIWBVZAJQ-DIZROUMASA-N
SMILES:O(C)[C@@H]1[C@@]23[C@@]4([C@H](OC)[C@@](O)([C@]2(N(CC)C[C@]4(CO)CC1)[H])[C@]5(O)[C@@]6([C@]3(C[C@@]([C@@H]6OC)([C@@H](OC)C5)[H])[H])[H])[H]
Synonyms:- (+)-Lycoctonine
- (1a,6b,14a,16b)-20-Ethyl-4-(hydroxymethyl)-1,6,14,16-tetramethoxyaconitane-7,8-diol
- (1alpha,6beta,14alpha,16beta)-20-Ethyl-4-(hydroxymethyl)-1,6,14,16-tetramethoxyaconitane-7,8-diol
- 26000-17-9
- 2H-12,3,6a-Ethanylylidene-7,9-methanonaphth[2,3-b]azocine, aconitane-7,8-diol deriv.
- Aconitane-7,8-diol, 20-ethyl-4-(hydroxymethyl)-1,6,14,16-tetramethoxy-, (1α,6β,14α,16β)-
- Delsine
- NSC 268791
- Roylin
- Royline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(+)-Lycoctonine
CAS:Compound TJS1874 is a useful organic compound for research related to life sciences. The catalog number is TJS1874 and the CAS number is 26000-17-9.Formula:C25H41NO7Color and Shape:SolidMolecular weight:467.6Lycoctonine
CAS:Controlled ProductLycoctonine is a diterpenoid alkaloid, which is a naturally occurring compound found primarily in the plant genus Aconitum. This compound is notable for its complex molecular structure characterized by a diterpene backbone. Lycoctonine exhibits its biological activity primarily through its interaction with the nervous system. It acts as a neuromuscular blocking agent, interfering with synaptic transmission at the neuromuscular junction, which can lead to muscle relaxation and paralysis.
Formula:C25H41NO7Purity:Min. 95%Color and Shape:PowderMolecular weight:467.6 g/mol

