CymitQuimica logo

CAS 260063-21-6

:

2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid

Description:
2,3-Dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a dioxine and a thieno moiety. This compound features a five-membered ring containing two oxygen atoms and a sulfur atom, contributing to its distinctive chemical properties. The presence of a carboxylic acid functional group enhances its polarity and solubility in polar solvents, making it potentially useful in various chemical applications. Its structure suggests potential reactivity, particularly in electrophilic substitution reactions or as a ligand in coordination chemistry. Additionally, compounds with similar structures may exhibit biological activity, making them of interest in pharmaceutical research. The compound's CAS number, 260063-21-6, allows for easy identification and retrieval of information in chemical databases. Overall, 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid represents a fascinating area of study within organic and medicinal chemistry due to its structural complexity and potential applications.
Formula:C7H6O4S
InChI:InChI=1/C7H6O4S/c8-7(9)6-5-4(3-12-6)10-1-2-11-5/h3H,1-2H2,(H,8,9)
InChI key:DCCRIIFBJZOPAV-UHFFFAOYSA-N
SMILES:C1COc2c(csc2C(=O)O)O1
Synonyms:
  • 2,3-dihydrothieno[3,4-B][1,4]dioxin-5-ylcarboxylic acid
Found 4 products.