CAS 26020-29-1
:Calendulaglycoside C
Description:
Calendulaglycoside C, with the CAS number 26020-29-1, is a natural compound derived from the flowers of the Calendula officinalis plant, commonly known as marigold. This compound belongs to the class of flavonoid glycosides, which are known for their diverse biological activities. Calendulaglycoside C is characterized by its glycosidic structure, where a sugar moiety is attached to a flavonoid backbone, enhancing its solubility and bioavailability. It exhibits antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and skin-soothing effects. Additionally, this compound is often studied for its role in traditional medicine and its applications in cosmetic formulations due to its ability to promote skin health. The presence of phenolic groups in its structure is responsible for its reactivity and interaction with various biological systems. Overall, Calendulaglycoside C represents a significant area of interest in phytochemistry and pharmacology, highlighting the importance of plant-derived compounds in therapeutic applications.
Formula:C48H76O19
InChI:InChI=1S/C48H76O19/c1-43(2)14-16-48(42(61)67-40-33(56)31(54)29(52)24(20-50)63-40)17-15-46(6)21(22(48)18-43)8-9-26-45(5)12-11-27(44(3,4)25(45)10-13-47(26,46)7)64-41-35(58)36(34(57)37(66-41)38(59)60)65-39-32(55)30(53)28(51)23(19-49)62-39/h8,22-37,39-41,49-58H,9-20H2,1-7H3,(H,59,60)/t22-,23+,24+,25-,26+,27-,28-,29+,30-,31-,32+,33+,34-,35+,36-,37-,39-,40-,41+,45-,46+,47+,48-/m0/s1
InChI key:InChIKey=QZMAEZWZCGBZFK-AOJWCAIYSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)(C(C)(C)[C@@H](O[C@H]7[C@H](O)[C@@H](O[C@@H]8O[C@H](CO)[C@H](O)[C@H](O)[C@H]8O)[C@H](O)[C@@H](C(O)=O)O7)CC6)[H])[H])(CC(C)(C)CC3)[H]
Synonyms:- β-D-Glucopyranosiduronic acid, (3β)-28-(β-D-glucopyranosyloxy)-28-oxoolean-12-en-3-yl 3-O-β-D-galactopyranosyl-
- Calendulaglycoside C
- Calenduloside H
- Calenduloside H
- CalendulaglycosideC
- (3β)-28-(β-D-Glucopyranosyloxy)-28-oxoolean-12-en-3-yl 3-O-β-D-galactopyranosyl-β-D-glucopyranosiduronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Calenduloside H
CAS:Calenduloside H is a useful organic compound for research related to life sciences. The catalog number is T125181 and the CAS number is 26020-29-1.Formula:C48H76O19Color and Shape:SolidMolecular weight:957.117
