CAS 26020-48-4
:3,4,5-Trichlorothiophene-2-carboxylic acid
Description:
3,4,5-Trichlorothiophene-2-carboxylic acid is a chlorinated derivative of thiophene, a five-membered aromatic heterocycle containing sulfur. This compound features three chlorine atoms substituted at the 3, 4, and 5 positions of the thiophene ring, along with a carboxylic acid functional group at the 2-position. The presence of multiple chlorine atoms enhances its reactivity and can influence its physical properties, such as solubility and boiling point. Typically, chlorinated compounds exhibit increased stability and resistance to degradation, making them useful in various applications, including agrochemicals and pharmaceuticals. The carboxylic acid group contributes to its acidity and potential for forming salts or esters. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the chlorine substituents, which can affect its behavior in chemical reactions and interactions with biological systems. Safety and handling precautions are essential due to the potential toxicity associated with chlorinated compounds.
Formula:C5HCl3O2S
InChI:InChI=1/C5HCl3O2S/c6-1-2(7)4(8)11-3(1)5(9)10/h(H,9,10)
SMILES:c1(c(c(Cl)sc1C(=O)O)Cl)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4,5-Trichlorothiophene-2-carboxylic acid
CAS:Formula:C5HCl3O2SPurity:%Color and Shape:SolidMolecular weight:231.48423,4,5-Trichlorothiophene-2-carboxylic acid
CAS:3,4,5-Trichlorothiophene-2-carboxylic acid is a heterocyclic compound with a radical group. This substance has been used as a fungicide and insecticide. It was also one of the first pesticides to be developed that could be used in organic farming. 3,4,5-Trichlorothiophene-2-carboxylic acid is able to hydrolyze in water and can be degraded by amines and amides. 3,4,5-Trichlorothiophene-2-carboxylic acid is also toxic to animals and humans.
Formula:C5HCl3O2SPurity:Min. 95%Color and Shape:White PowderMolecular weight:231.48 g/mol




