CymitQuimica logo

CAS 260246-17-1

:

3-(3-fluoro-phenyl)-3-oxo-propionic acid methyl ester

Description:
3-(3-Fluoro-phenyl)-3-oxo-propionic acid methyl ester, with the CAS number 260246-17-1, is an organic compound characterized by its ester functional group and the presence of a fluorinated aromatic ring. This compound features a propionic acid backbone, where the carbonyl group is adjacent to a phenyl ring substituted with a fluorine atom, which can influence its chemical reactivity and physical properties. The methyl ester group enhances its solubility in organic solvents and may affect its biological activity. Typically, compounds like this may exhibit interesting pharmacological properties due to the presence of the fluorine atom, which can enhance lipophilicity and metabolic stability. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its synthesis and characterization would involve standard organic chemistry techniques, including esterification and possibly fluorination reactions. Overall, this compound represents a class of molecules that are of interest in both synthetic and medicinal chemistry due to their unique structural features and potential applications.
Formula:C10H9FO3
InChI:InChI=1S/C10H9FO3/c1-14-10(13)6-9(12)7-3-2-4-8(11)5-7/h2-5H,6H2,1H3
InChI key:SMVCLVGDGBKTMN-UHFFFAOYSA-N
SMILES:COC(=O)CC(=O)C1=CC(=CC=C1)F
Found 3 products.