CAS 26028-63-7

5-(3-chlorophenyl)-4-ethyl-4H-1,2,4-triazole-3-thiol

Description:

5-(3-Chlorophenyl)-4-ethyl-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a chlorophenyl group, contributing to its potential biological activity and lipophilicity. The presence of the thiol (-SH) group is significant, as it can participate in redox reactions and may influence the compound's reactivity and interaction with biological systems. The ethyl substituent enhances the hydrophobic character of the molecule, potentially affecting its solubility and permeability. This compound is of interest in various fields, including medicinal chemistry and agricultural science, due to its potential fungicidal or herbicidal properties. Its specific applications and efficacy would depend on further studies and evaluations. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₀H₁₀ClN₃S

InChI: InChI=1/C10H10ClN3S/c1-2-14-9(12-13-10(14)15)7-4-3-5-8(11)6-7/h3-6H,2H2,1H3,(H,13,15)

SMILES: CCn1c(c2cccc(c2)Cl)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-(3-chlorophenyl)-4-ethyl-

5-(3-Chlorophenyl)-4-ethyl-4H-1,2,4-triazole-3-thiol

CAS: 26028-63-7

5-(3-Chlorophenyl)-4-ethyl-4H-1,2,4-triazole-3-thiol

Purity: ≥95%

Molecular weight: 239.72g/mol

Ref: 54-OR14455