CAS 26032-72-4
:2,4-dichloro-6-phenylpyrimidine
Description:
2,4-Dichloro-6-phenylpyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The compound features two chlorine substituents at the 2 and 4 positions of the pyrimidine ring, contributing to its reactivity and potential applications in various chemical reactions. The presence of a phenyl group at the 6 position enhances its lipophilicity and may influence its biological activity. This compound is typically a solid at room temperature and is soluble in organic solvents. It is often utilized in the synthesis of pharmaceuticals and agrochemicals due to its ability to act as an intermediate in chemical reactions. Additionally, the dichloro and phenyl substituents can impart specific properties that may be beneficial in medicinal chemistry, such as enhancing potency or selectivity. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C10H6Cl2N2
InChI:InChI=1/C10H6Cl2N2/c11-9-6-8(13-10(12)14-9)7-4-2-1-3-5-7/h1-6H
SMILES:c1ccc(cc1)c1cc(Cl)nc(Cl)n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4-Dichloro-6-phenylpyrimidine
CAS:Formula:C10H6Cl2N2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:225.072,4-Dichloro-6-phenylpyrimidine
CAS:2,4-Dichloro-6-phenylpyrimidineFormula:C10H6Cl2N2Purity:>98%Molecular weight:225.0782,4-Dichloro-6-phenylpyrimidine
CAS:Formula:C10H6Cl2N2Purity:98%Color and Shape:SolidMolecular weight:225.07402,4-Dichloro-6-phenylpyrimidine
CAS:2,4-Dichloro-6-phenylpyrimidineFormula:C10H6Cl2N2Purity:97%Molecular weight:225.072,4-Dichloro-6-phenylpyrimidine
CAS:Formula:C10H6Cl2N2Purity:98%Color and Shape:SolidMolecular weight:225.072,4-Dichloro-6-phenylpyrimidine
CAS:2,4-Dichloro-6-phenylpyrimidine is a nucleophilic reagent that has been used to synthesize pyrimidine derivatives. It has been shown to react with cyanoacetic acid and malononitrile in the presence of an organolithium reagent to form 2,6-dichloro-2,4-dihydroxypyrimidine. This compound reacts with chlorine gas to give 2,4-dichloro-6-(chloromethyl)pyrimidine. This reaction is regioselective and does not affect the other substituents on the ring. The reaction proceeds via a nucleophilic attack on the carbon atom adjacent to the nitrogen atom.
Formula:C10H6Cl2N2Purity:Min. 95%Molecular weight:225.07 g/mol





