CAS 26033-20-5

5-phenyl-1H-pyrazole-4-carbaldehyde

Description:

5-Phenyl-1H-pyrazole-4-carbaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group attached to the pyrazole ring, enhancing its aromatic properties. The presence of the aldehyde functional group (-CHO) at the 4-position of the pyrazole ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and oxidation. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound is of interest in medicinal chemistry and material science due to its potential biological activities and applications in synthesizing other complex molecules. Additionally, its unique structure allows for various modifications, which can lead to derivatives with enhanced properties. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₀H₈N₂O

InChI: InChI=1/C10H8N2O/c13-7-9-6-11-12-10(9)8-4-2-1-3-5-8/h1-7H,(H,11,12)

SMILES: c1ccc(cc1)c1c(c[nH]n1)C=O

Synonyms:

• 1H-Pyrazole-4-carboxaldehyde, 3-phenyl-
• 1H-pyrazole-4-carboxaldehyde, 5-phenyl-
• 3-Phenyl-1H-pyrazole-4-carbaldehyde

5-Phenyl-1h-pyrazole-4-carbaldehyde

CAS: 26033-20-5

Formula: C₁₀H₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 172.1833

Ref: IN-DA002RFS

3-Phenyl-1H-pyrazole-4-carboxaldehyde

CAS: 26033-20-5

3-Phenyl-1H-pyrazole-4-carboxaldehyde

Purity: 98%

Molecular weight: 172.18g/mol

Ref: 54-OR8144

3-Phenyl-1H-pyrazole-4-carbaldehyde

CAS: 26033-20-5

Formula: C₁₀H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.187

Ref: 10-F015669