CAS 26034-16-2
:N-acetyl-N-methylvalyl-N,4-dimethyl-N-[2,10,17,25-tetramethyl-6,16,27-tris(2-methylpropyl)-5,8,12,15,18,23,26,29-octaoxo-24-(propan-2-yl)hexacosahydro-1H,12H-dipyrrolo[2,1-i:2',1'-r][1,4,7,10,13,16,19,22]oxaheptaazacyclopentacosin-9-yl]prolinamide
Description:
N-acetyl-N-methylvalyl-N,4-dimethyl-N-[2,10,17,25-tetramethyl-6,16,27-tris(2-methylpropyl)-5,8,12,15,18,23,26,29-octaoxo-24-(propan-2-yl)hexacosahydro-1H,12H-dipyrrolo[2,1-i:2',1'-r][1,4,7,10,13,16,19,22]oxaheptaazacyclopentacosin-9-yl]prolinamide, with CAS number 26034-16-2, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups and a large number of carbon atoms. This substance features a combination of amide and acetyl functional groups, contributing to its potential biological activity. The presence of multiple methyl and propyl groups suggests a degree of hydrophobicity, which may influence its solubility and interaction with biological membranes. The compound's extensive cyclic and polycyclic framework indicates potential for unique conformational properties, which could affect its reactivity and stability. Such complex molecules are often studied for their potential applications in pharmaceuticals, materials science, or as catalysts, although specific applications would depend on further research into their properties and behavior in various environments.
Formula:C57H96N10O12
InChI:InChI=1/C57H96N10O12/c1-19-34(10)43-54(75)62(16)46(31(6)7)56(77)65-24-22-23-39(65)52(73)63(17)47(36(12)21-3)50(71)58-27-42(69)79-37(13)48(51(72)60-44(35(11)20-2)55(76)66-28-32(8)25-40(66)49(70)59-43)64(18)53(74)41-26-33(9)29-67(41)57(78)45(30(4)5)61(15)38(14)68/h30-37,39-41,43-48H,19-29H2,1-18H3,(H,58,71)(H,59,70)(H,60,72)/t32-,33-,34?,35?,36?,37-,39?,40?,41?,43+,44+,45+,46+,47-,48-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Griselimycin
CAS:Griselimycin is a natural antimycobacterial product that is currently being pursued as a therapy for tuberculosis.Formula:C57H96N10O12Purity:98%Color and Shape:SolidMolecular weight:1113.453Griselimycin
CAS:<p>Griselimycin is an antibiotic, which is derived from the bacterial genus *Streptomyces*. This compound exhibits its mode of action by targeting bacterial protein synthesis, specifically binding to the DNA polymerase sliding clamp, thereby inhibiting replication and cell division in a range of bacterial pathogens. Griselimycin has been the focus of renewed scientific interest due to its potent activity against Mycobacterium tuberculosis, including multi-drug-resistant strains. The compound’s unique mode of action makes it a promising candidate for further development in the treatment of tuberculosis and potentially other bacterial infections that have developed resistance to more commonly used antibiotics. Advances in understanding its biosynthesis have facilitated semi-synthetic modifications, potentially enhancing its pharmacokinetic properties and antimicrobial spectrum. The applications of Griselimycin extend to research contexts where understanding resistance mechanisms and novel antibiotic development are critical. Continued exploration of this compound may contribute significantly to addressing the global challenge of antibiotic resistance.</p>Formula:C57H96N10O12Purity:Min. 95%Molecular weight:1112.72092


