CymitQuimica logo

CAS 260355-20-2

:

2-Chloro-5-iodobenzotrifluoride

Description:
2-Chloro-5-iodobenzotrifluoride is an aromatic halogenated compound characterized by the presence of a benzene ring substituted with three fluorine atoms, a chlorine atom, and an iodine atom. Its molecular structure features a trifluoromethyl group (-CF3) and halogen substituents that significantly influence its chemical properties, including reactivity and polarity. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its stability under standard conditions but can undergo reactions typical of aromatic halides, such as nucleophilic substitution. The presence of multiple halogens makes it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its unique combination of halogen atoms can impart specific electronic and steric effects, making it valuable in materials science and chemical research. Safety precautions should be observed when handling this compound, as it may pose health risks due to its halogenated nature.
Formula:C7H3ClF3I
InChI:InChI=1/C7H3ClF3I/c8-6-2-1-4(12)3-5(6)7(9,10)11/h1-3H
InChI key:MCIFWVOVVPVBRJ-UHFFFAOYSA-N
SMILES:c1cc(c(cc1I)C(F)(F)F)Cl
Synonyms:
  • 1-Chloro-4-iodo-2-(trifluoromethyl)benzene
Found 5 products.