
CAS 26038-69-7
:1,4-Cyclohexanedicarboxylic acid, compd. with 1,6-hexanediamine (1:1)
Description:
1,4-Cyclohexanedicarboxylic acid, compd. with 1,6-hexanediamine (1:1), identified by CAS number 26038-69-7, is a chemical compound formed from the reaction of 1,4-cyclohexanedicarboxylic acid and 1,6-hexanediamine. This compound typically exhibits characteristics of both its acidic and amine components, resulting in a solid structure that may display properties such as solubility in polar solvents and potential for hydrogen bonding due to the presence of carboxylic acid and amine functional groups. It is often utilized in the synthesis of polyamides and other polymeric materials, contributing to the development of thermoplastic elastomers and resins. The compound may also exhibit moderate thermal stability and can participate in various chemical reactions, including esterification and amidation. Its applications extend to fields such as materials science and organic synthesis, where it serves as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C14H28N2O4
InChI:InChI=1S/C8H12O4.C6H16N2/c9-7(10)5-1-2-6(4-3-5)8(11)12;7-5-3-1-2-4-6-8/h5-6H,1-4H2,(H,9,10)(H,11,12);1-8H2
InChI key:InChIKey=HIBQVFMFYVZWNI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCC(C(O)=O)CC1.C(CCCN)CCN
Synonyms:- Hexamethylenediammonium hexahydroterephthalate (1:1)
- 1,4-Cyclohexanedicarboxylic acid, compd. with 1,6-hexanediamine (1:1)
- 1,6-Hexanediamine, 1,4-cyclohexanedicarboxylate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4-Cyclohexanedicarboxylic acid, compd. with 1,6-hexanediamine (1:1)
CAS:Formula:C14H28N2O4Molecular weight:288.3831
