CymitQuimica logo

CAS 260413-62-5

:

ligustroflavone

Description:
Ligustroflavone is a flavonoid compound primarily derived from plants in the Ligusticum genus, known for its potential pharmacological properties. It is characterized by its polyphenolic structure, which typically includes multiple hydroxyl groups that contribute to its antioxidant activity. Ligustroflavone has been studied for various biological activities, including anti-inflammatory, neuroprotective, and anticancer effects. Its mechanism of action often involves the modulation of signaling pathways and the inhibition of specific enzymes. The compound is soluble in organic solvents and exhibits varying solubility in water, which can influence its bioavailability and therapeutic efficacy. Additionally, ligustroflavone may interact with other compounds, enhancing or inhibiting their effects, making it a subject of interest in herbal medicine and pharmacology. Ongoing research continues to explore its potential applications in health and disease management, highlighting the importance of understanding its chemical properties and biological interactions.
Formula:C33H40O18
InChI:InChI=1S/C33H40O18/c1-11-22(37)25(40)28(43)31(46-11)45-10-20-24(39)27(42)30(51-32-29(44)26(41)23(38)12(2)47-32)33(50-20)48-15-7-16(35)21-17(36)9-18(49-19(21)8-15)13-3-5-14(34)6-4-13/h3-9,11-12,20,22-35,37-44H,10H2,1-2H3/t11-,12-,20+,22-,23-,24+,25+,26+,27-,28+,29+,30+,31+,32-,33+/m0/s1
InChI key:NULBHTHMVOCGOE-ZBCCAYPVSA-N
SMILES:C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)O)O)O[C@H]6[C@@H]([C@@H]([C@H]([C@@H](O6)C)O)O)O)O)O)O)O)O
Found 8 products.