CymitQuimica logo

CAS 260441-69-8

:

1-{[(E)-2-phenylethenyl]sulfonyl}piperidine-4-carboxylic acid

Description:
1-{[(E)-2-phenylethenyl]sulfonyl}piperidine-4-carboxylic acid is a chemical compound characterized by its unique structural features, which include a piperidine ring, a carboxylic acid functional group, and a sulfonyl group attached to a phenyl-substituted vinyl moiety. This compound exhibits properties typical of both acidic and basic functional groups, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The presence of the sulfonyl group enhances its reactivity and solubility in polar solvents, while the piperidine ring contributes to its potential biological activity. The compound's stereochemistry, particularly the (E)-configuration of the vinyl group, plays a crucial role in its interactions with biological targets. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural complexity and potential for diverse biological activities. Its specific characteristics, such as melting point, solubility, and reactivity, would need to be determined through experimental methods for practical applications.
Formula:C14H17NO4S
InChI:InChI=1/C14H17NO4S/c16-14(17)13-6-9-15(10-7-13)20(18,19)11-8-12-4-2-1-3-5-12/h1-5,8,11,13H,6-7,9-10H2,(H,16,17)/b11-8+
InChI key:LAFAILDKFOBJFF-DHZHZOJOSA-N
SMILES:C1CN(CCC1C(=O)O)S(=O)(=O)/C=C/C2=CC=CC=C2
Synonyms:
  • 1-{[(E)-2-Phenylvinyl]sulfonyl}piperidine-4-carboxylic acid
  • 4-Piperidinecarboxylic acid, 1-[[(E)-2-phenylethenyl]sulfonyl]-
Found 5 products.