CAS 26048-05-5: beauvericin
Description:Beauvericin is a cyclic hexadepsipeptide mycotoxin produced by various species of fungi, particularly those in the Beauveria and Fusarium genera. It is characterized by its unique structure, which consists of alternating amino acid and hydroxy acid residues, forming a cyclic arrangement. Beauvericin exhibits a range of biological activities, including cytotoxicity and immunosuppressive effects, making it of interest in both toxicology and pharmacology. It has been shown to interfere with cellular processes, such as apoptosis and ion transport, particularly affecting potassium channels. This compound is also notable for its potential as a biopesticide, given its antifungal properties. However, its presence in food and feed products raises concerns regarding safety and regulatory limits, as it can pose health risks to humans and animals. Analytical methods, such as liquid chromatography coupled with mass spectrometry, are commonly employed to detect and quantify beauvericin in various matrices. Overall, while beauvericin has potential applications, its toxicological profile necessitates careful handling and monitoring.
Formula:C45H57N3O9
InChI:InChI=1/C45H57N3O9/c1-28(2)37-40(49)46(7)35(26-32-21-15-11-16-22-32)44(53)56-39(30(5)6)42(51)48(9)36(27-33-23-17-12-18-24-33)45(54)57-38(29(3)4)41(50)47(8)34(43(52)55-37)25-31-19-13-10-14-20-31/h10-24,28-30,34-39H,25-27H2,1-9H3/t34-,35-,36-,37+,38+,39+/m0/s1
- Synonyms:
- Cyclo(-D-.alpha.-hydroxyisovaleryl-N-Me-Phe)3
- (3S,6R,9S,12R,15S,18R)-3,9,15-tribenzyl-4,10,16-trimethyl-6,12,18-tris(1-methylethyl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone