CAS 26048-95-3
:Carbamic acid, [1-[(benzyloxy)carbamoyl]-2-hydroxyethyl]-, benzyl ester, DL-
Description:
Carbamic acid, [1-[(benzyloxy)carbamoyl]-2-hydroxyethyl]-, benzyl ester, DL- (CAS 26048-95-3) is a chemical compound characterized by its carbamic acid functional group, which is linked to a benzyl ester and a hydroxyethyl moiety. This compound typically exhibits properties associated with both carbamates and esters, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the benzyloxy group suggests that it may have aromatic characteristics, which can influence its reactivity and interactions with other molecules. The hydroxyethyl group introduces a polar functional group, potentially enhancing solubility in polar solvents. As a derivative of carbamic acid, it may participate in reactions typical of amides and esters, such as hydrolysis or transesterification. Additionally, the DL designation indicates that the compound may exist as a racemic mixture of enantiomers, which can affect its biological activity and pharmacological properties. Overall, this compound's unique structure may confer specific applications in medicinal chemistry or as an intermediate in organic synthesis.
Formula:C18H20N2O5
InChI:InChI=1S/C18H20N2O5/c21-11-16(17(22)20-25-13-15-9-5-2-6-10-15)19-18(23)24-12-14-7-3-1-4-8-14/h1-10,16,21H,11-13H2,(H,19,23)(H,20,22)
InChI key:InChIKey=ATHRZWZDILASFM-UHFFFAOYSA-N
SMILES:C(OC(NC(C(NOCC1=CC=CC=C1)=O)CO)=O)C2=CC=CC=C2
Synonyms:- Carbamic acid, [1-[(benzyloxy)carbamoyl]-2-hydroxyethyl]-, benzyl ester, DL-
- Carbamic acid, [1-[(benzyloxy)carbamoyl]-2-hydroxyethyl]-, benzyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(R,S)-[1-[(Benzyloxy)carbamoyl]-2-hydroxyethyl]carbamic Acid Benzyl Ester
CAS:Controlled ProductApplications Intermediate for synthesis of D,L-Alanosine.
Formula:C18H20N2O5Color and Shape:NeatMolecular weight:344.36

