CAS 26049-71-8
:4-(2-hydrazinyl-1,3-thiazol-4-yl)aniline
Description:
4-(2-Hydrazinyl-1,3-thiazol-4-yl)aniline, identified by its CAS number 26049-71-8, is an organic compound characterized by the presence of both hydrazine and thiazole functional groups. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents due to its hydrophilic nature. The thiazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The hydrazine moiety can participate in various chemical reactions, including condensation and oxidation, which may lead to the formation of more complex structures. Additionally, the compound may display properties such as antimicrobial or antitumor activity, although specific biological effects would depend on the context of its use and the presence of other substituents. Safety data should be consulted, as compounds containing hydrazine derivatives can be hazardous. Overall, 4-(2-hydrazinyl-1,3-thiazol-4-yl)aniline represents a versatile building block in organic synthesis and drug development.
Formula:C9H10N4S
InChI:InChI=1/C9H10N4S/c10-7-3-1-6(2-4-7)8-5-14-9(12-8)13-11/h1-5H,10-11H2,(H,12,13)
SMILES:c1cc(ccc1c1csc(n1)NN)N
Synonyms:- 2(3H)-thiazolone, 4-(4-aminophenyl)-, hydrazone, (2Z)-
- 4-(2-Hydrazino-1,3-thiazol-4-yl)aniline
- Benzenamine, 4-(2-hydrazinyl-4-thiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
