CymitQuimica logo

CAS 260552-98-5

:

Benzoyl chloride, 2,6-difluoro-3-nitro-

Description:
Benzoyl chloride, 2,6-difluoro-3-nitro- is an organic compound characterized by the presence of a benzoyl group attached to a chlorine atom, along with two fluorine atoms and a nitro group on the aromatic ring. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a potent electrophile. The difluoro and nitro substituents contribute to its unique electronic properties, influencing its reactivity and potential applications in organic synthesis. It is often used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Due to its reactive nature, it can be hazardous, requiring careful handling and storage to avoid exposure. Safety measures should be taken to prevent contact with skin or inhalation of vapors, as it can be corrosive and irritating.
Formula:C7H2ClF2NO3
InChI:InChI=1S/C7H2ClF2NO3/c8-7(12)5-3(9)1-2-4(6(5)10)11(13)14/h1-2H
InChI key:URMNSJGLMUMDDC-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1[N+](=O)[O-])F)C(=O)Cl)F
Found 4 products.