CymitQuimica logo

CAS 260558-15-4

:

4-Bromo-2-iodo-1-methylbenzene

Description:
4-Bromo-2-iodo-1-methylbenzene, also known as 1-methyl-4-bromo-2-iodobenzene, is an aromatic compound characterized by the presence of a methyl group, a bromine atom, and an iodine atom attached to a benzene ring. Its molecular structure features a methyl group at the first position, a bromine substituent at the para position (fourth carbon), and an iodine substituent at the meta position (second carbon) relative to the methyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity in various organic synthesis reactions, particularly in nucleophilic substitution and cross-coupling reactions, due to the presence of the halogen substituents. The presence of both bromine and iodine makes it a valuable intermediate in the synthesis of more complex organic molecules. Additionally, it may exhibit specific physical properties such as solubility in organic solvents and varying boiling and melting points, influenced by its halogen content.
Formula:C7H6BrI
InChI:InChI=1S/C7H6BrI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3
InChI key:InChIKey=LRVKMSDCJCZTTB-UHFFFAOYSA-N
SMILES:IC1=C(C)C=CC(Br)=C1
Synonyms:
  • 4-Bromo-2-iodotoluene
  • Benzene, 4-bromo-2-iodo-1-methyl-
  • 4-Bromo-2-iodo-1-methylbenzene
Found 5 products.