CAS 26060-30-0
:4-nitrobenzenecarbothioamide
Description:
4-Nitrobenzenecarbothioamide, with the CAS number 26060-30-0, is an organic compound characterized by the presence of a nitro group (-NO2) and a thioamide functional group (-C(S)NH2) attached to a benzene ring. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The nitro group contributes to its reactivity, making it a useful intermediate in organic synthesis. The thioamide functionality can participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Additionally, 4-nitrobenzenecarbothioamide may exhibit biological activity, which can be explored for potential therapeutic uses. Its solubility properties can vary depending on the solvent, and it is important to handle this compound with care due to the presence of the nitro group, which can be sensitive to reduction reactions. Overall, 4-nitrobenzenecarbothioamide is a versatile compound with significant implications in chemical research and development.
Formula:C7H6N2O2S
InChI:InChI=1/C7H6N2O2S/c8-7(12)5-1-3-6(4-2-5)9(10)11/h1-4H,(H2,8,12)
SMILES:c1cc(ccc1C(=S)N)N(=O)=O
Synonyms:- Benzenecarbothioamide, 4-Nitro-
- 4-Nitrobenzenecarbothioamide
- 4-nitrobenzothioamide
- p-Nitrothiobenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Nitrothiobenzamide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H6N2O2SPurity:97%Molecular weight:182.24-nitrobenzene-1-carbothioamide
CAS:Formula:C7H6N2O2SPurity:97%(HPLC);RGColor and Shape:SolidMolecular weight:182.2
