CymitQuimica logo

CAS 2607-03-6

:

dimethyl cyclobutane-1,2-dicarboxylate

Description:
Dimethyl cyclobutane-1,2-dicarboxylate is an organic compound characterized by its cyclic structure and the presence of two carboxylate groups esterified with methyl groups. It features a cyclobutane ring, which is a four-membered carbon ring, contributing to its unique strain and reactivity. The compound is typically colorless to pale yellow in appearance and is known for its relatively low volatility. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic cyclobutane framework. Dimethyl cyclobutane-1,2-dicarboxylate is often utilized in organic synthesis, particularly in the preparation of various derivatives and as an intermediate in the synthesis of more complex molecules. Its reactivity is influenced by the presence of the dicarboxylate groups, which can participate in various chemical reactions, including esterification and nucleophilic substitutions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled.
Formula:C8H12O4
InChI:InChI=1/C8H12O4/c1-11-7(9)5-3-4-6(5)8(10)12-2/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1
InChI key:WEPHXFVXUXMCLE-UHFFFAOYSA-N
SMILES:COC(=O)[C@@H]1CC[C@H]1C(=O)OC
Synonyms:
  • 1,2-Cyclobutanedicarboxylic acid, dimethyl ester
  • 1,2-Cyclobutanedicarboxylic acid, dimethyl ester, cis-
  • cis-Dimethyl 1,2-Cyclobutanedicarboxylate
Found 3 products.